| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| ChemBridge Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Name | 2,5-Dianilinoterephthalic Acid |
|---|---|
| Synonyms | Oprea1_567229; 1,4-Benzenedicarboxylic Acid, 2,5-Bis(Phenylamino)-; 2,5-Dianilinoterephthalic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 |
| CAS Registry Number | 10109-95-2 |
| EINECS | 233-302-8 |
| SMILES | C1=C(C(O)=O)C(=CC(=C1NC2=CC=CC=C2)C(O)=O)NC3=CC=CC=C3 |
| InChI | 1S/C20H16N2O4/c23-19(24)15-12-18(22-14-9-5-2-6-10-14)16(20(25)26)11-17(15)21-13-7-3-1-4-8-13/h1-12,21-22H,(H,23,24)(H,25,26) |
| InChIKey | ZJQZWNLKRBUEKX-UHFFFAOYSA-N |
| Density | 1.413g/cm3 (Cal.) |
|---|---|
| Boiling point | 559.758°C at 760 mmHg (Cal.) |
| Flash point | 292.332°C (Cal.) |
| (1) | M. U. Schmidt, T. Schmiermund and M. Bolte. Disodium 2,5-bis(phenylamino)terephthalate decahydrate, an intermediate in the industrial synthesis of quinacridone pigments, Acta Cryst. (2006). C62, m37-m40 |
|---|---|
| Market Analysis Reports |