Online Database of Chemicals from Around the World
(3R,3aR,6R,6aR)-6-[[6-chloro-5-(4-phenylphenyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol
[CAS 1394371-71-1]
Identification| Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-(4-phenylphenyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|
| Synonyms | MK8722 |
|
| Molecular Structure | ![(3R,3aR,6R,6aR)-6-[[6-chloro-5-(4-phenylphenyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol molecular structure (CAS 1394371-71-1)](/structures/1394371-71-1.png) |
| Molecular Formula | C24H20ClN3O4 |
| Molecular Weight | 449.89 |
| CAS Registry Number | 1394371-71-1 |
| SMILES | C1[C@H]([C@@H]2[C@H](O1)[C@@H](CO2)OC3=NC4=NC(=C(C=C4N3)Cl)C5=CC=C(C=C5)C6=CC=CC=C6)O |
|
Properties
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.688, Calc.* |
| Boiling Point | 716.6±70.0 °C (760 mmHg), Calc.* |
| Flash Point | 387.2±35.7 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Related Products