| Zhengzhou Kingorgchem Chemical Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.kingorgchem.com | |||
![]() | +86 (371) 6551-1006 | |||
![]() | +86 (371) 6575-6965 | |||
![]() | sales@kingorgchem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 18625597674 | |||
| Chemical manufacturer since 2015 | ||||
| chemBlink Standard supplier since 2016 | ||||
| Classification | Organic raw materials >> Organometallic compound >> Organic palladium |
|---|---|
| Name | Methanesulfonato(tricyclohexylphosphine)(2'-amino-1,1'-biphenyl-2-yl)palladium(II) |
| Synonyms | P(Cy3) Pd G3 |
| Molecular Structure | ![]() |
| Molecular Formula | C31H46NO3PPdS |
| Molecular Weight | 650.16 |
| CAS Registry Number | 1445086-12-3 |
| SMILES | CS(=O)(=O)O[Pd]c1ccccc1c2ccccc2N.C1CCC(CC1)P(C2CCCCC2)C3CCCCC3 |
| Melting point | 219-224 °C (decomp.) |
|---|---|
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details |
| SDS | Available |
|
Methanesulfonato(tricyclohexylphosphine)(2'-amino-1,1'-biphenyl-2-yl)palladium(II) is a specialized palladium(II) complex known for its unique ligand environment and catalytic applications. This compound features a palladium center coordinated by a methanesulfonate group, a tricyclohexylphosphine ligand, and a 2'-amino-1,1'-biphenyl-2-yl group. The combination of these ligands imparts distinctive properties to the complex, enhancing its utility in various chemical processes. The discovery of this complex is part of ongoing research into palladium-based catalysts. Palladium complexes are widely used in organic synthesis due to their ability to participate in a range of reactions, including cross-coupling and oxidative processes. The unique ligand environment of Methanesulfonato(tricyclohexylphosphine)(2'-amino-1,1'-biphenyl-2-yl)palladium(II) contributes to its stability and reactivity, making it an important tool in modern chemistry. The tricyclohexylphosphine ligand in this complex is notable for its steric bulk and electronic properties. Tricyclohexylphosphine stabilizes the palladium center and influences its reactivity by providing a substantial steric environment. This steric protection helps prevent catalyst deactivation and promotes high selectivity in chemical reactions. Additionally, the phosphine ligand enhances the electron-donating ability of the palladium center, making it more reactive towards various substrates. The 2'-amino-1,1'-biphenyl-2-yl group serves as a bidentate ligand, coordinating to the palladium center through both the amino and biphenyl moieties. This coordination contributes to the overall stability of the complex and affects its electronic properties. The amino group can engage in hydrogen bonding interactions, which may influence the reactivity and selectivity of the catalyst in certain reactions. Methanesulfonate acts as a counterion in this complex, and its role is to balance the charge of the palladium center while also participating in the reaction mechanism. The methanesulfonate group is relatively inert but helps maintain the solubility and stability of the complex in various solvents. One of the primary applications of Methanesulfonato(tricyclohexylphosphine)(2'-amino-1,1'-biphenyl-2-yl)palladium(II) is in cross-coupling reactions, such as the Suzuki-Miyaura coupling. These reactions are crucial for forming carbon-carbon bonds and are widely used in the synthesis of pharmaceuticals, agrochemicals, and materials. The unique ligand environment of this complex enhances its performance in such reactions, providing high efficiency and selectivity. In addition to cross-coupling reactions, this palladium complex is also explored in other catalytic processes, including oxidative and reduction reactions. Its versatility in catalysis makes it a valuable tool for developing new chemical transformations and optimizing existing processes. In summary, Methanesulfonato(tricyclohexylphosphine)(2'-amino-1,1'-biphenyl-2-yl)palladium(II) is an advanced palladium(II) complex with significant potential in organic synthesis. Its unique ligand environment provides stability and reactivity, making it a valuable asset in various catalytic applications. References none |
| Market Analysis Reports |