| APIChem Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8678-2096 | |||
![]() |
sales@apichemistry.com | |||
| Chemical manufacturer since 2009 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 4-[Di(Phenyl)Methoxy]-1-Methylpiperidine |
|---|---|
| Synonyms | 4-[Di(Phenyl)Methoxy]-1-Methyl-Piperidine; Kbioss_001482; Spectrum2_000982 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 |
| CAS Registry Number | 147-20-6 |
| EINECS | 205-686-7 |
| SMILES | C3=C(C(OC1CCN(CC1)C)C2=CC=CC=C2)C=CC=C3 |
| InChI | 1S/C19H23NO/c1-20-14-12-18(13-15-20)21-19(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,18-19H,12-15H2,1H3 |
| InChIKey | OWQUZNMMYNAXSL-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.7±42.0°C at 760 mmHg (Cal.) |
| Flash point | 111.6±30.2°C (Cal.) |
| (1) | Dessislava Georgieva, Kerstin Greunke and Christian Betzel. Three-dimensional model of the honeybee venom allergen Api m 7: structural and functional insights, Mol. Biosyst., 2010, 6, 1056. |
|---|---|
| Market Analysis Reports |