| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 5,8-Dihydroxy-3-Methyl-9H-Benzo[f][2]Benzoxol-4-One |
|---|---|
| Synonyms | 5,8-Dihydroxy-3-Methyl-9H-Benzo[F]Isobenzofuran-4-One; 5,8-Dihydroxy-3-Methyl-9H-Naphtho[2,3-C]Furan-4-One; Nchembio.2007.14-Comp2 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10O4 |
| Molecular Weight | 230.22 |
| CAS Registry Number | 150045-18-4 |
| SMILES | C1=C3C(=C(O1)C)C(C2=C(C=CC(=C2C3)O)O)=O |
| InChI | 1S/C13H10O4/c1-6-11-7(5-17-6)4-8-9(14)2-3-10(15)12(8)13(11)16/h2-3,5,14-15H,4H2,1H3 |
| InChIKey | TZUYDLKHNQUNKS-UHFFFAOYSA-N |
| Density | 1.453g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.687°C at 760 mmHg (Cal.) |
| Flash point | 225.158°C (Cal.) |
| (1) | Meisner, et al.. Identification and mechanistic characterization of low molecular weight inhibitors of HuR, Nature Chemical Biology, 2007 |
|---|---|
| Market Analysis Reports |