| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | Fawcettimine |
|---|---|
| Synonyms | Fawcettimine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 |
| CAS Registry Number | 15228-74-7 |
| SMILES | [C@@]123[C@]4(O)N(CCC1)CCC[C@@H]2C(=O)C[C@@H]3C[C@H](C4)C |
| InChI | 1S/C16H25NO2/c1-11-8-12-9-14(18)13-4-2-6-17-7-3-5-15(12,13)16(17,19)10-11/h11-13,19H,2-10H2,1H3/t11-,12+,13-,15+,16+/m1/s1 |
| InChIKey | ZLMYGBDFISIGLH-WALBABNVSA-N |
| Density | 1.193g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.861°C at 760 mmHg (Cal.) |
| Flash point | 199.862°C (Cal.) |
| (1) | Liu Kuan-Miao. Intermolecular radical addition reactions of α-iodo cycloalkenones and a synthetic study of the formal synthesis of enantiopure fawcettimine, Chemical Communications, 2008 |
|---|---|
| Market Analysis Reports |