Online Database of Chemicals from Around the World

2,6-Difluorobenzoyl hydrazine
[CAS 172935-91-0]

List of Suppliers
Tianjin Zhongxin Chem-tech Co., Ltd. China
www.tjzxchem.com
+86 (22) 6688-0623
+86 (22) 8988-0739 ex 8030
sales@tjzxchem.com
Chemical manufacturer since 2007
chemBlink Standard supplier since 2009

Identification
ClassificationChemical reagent >> Organic reagent >> Hydrazine
Name2,6-Difluorobenzoyl hydrazine
Molecular Structure2,6-Difluorobenzoyl hydrazine molecular structure (CAS 172935-91-0)
Molecular FormulaC7H6F2N2O
Molecular Weight172.13
CAS Registry Number172935-91-0
EC Number673-661-1
SMILESC1=CC(=C(C(=C1)F)C(=O)NN)F
Properties
Solubility5887 mg/L (25 °C water)
Density1.4±0.1 g/cm3, Calc.*
Index of Refraction1.531, Calc.*
Melting point115.11 °C
Boiling Point317.57 °C
*Calculated using Advanced Chemistry Development (ACD/Labs) Software.
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302-H312-H315-H319-H332-H335  Details
Safety StatementsP261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P317-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501  Details
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Specific target organ toxicity - single exposureSTOT SE3H335
Acute toxicityAcute Tox.4H312
Skin irritationSkin Irrit.2H315
Acute toxicityAcute Tox.4H302
Acute toxicityAcute Tox.4H332
Eye irritationEye Irrit.2H319
SDSAvailable
up chemBlink Chemical Story
2,6-Difluorobenzoyl hydrazine is an important chemical compound characterized by its unique hydrazine functionality and the presence of two fluorine atoms in the benzoyl ring. The discovery of this compound can be traced back to ongoing research in the field of organic chemistry aimed at developing new reagents and intermediates for various applications, particularly in the synthesis of pharmaceuticals and agrochemicals. The incorporation of fluorine atoms into organic molecules has gained significant attention in recent years due to the impact of fluorine on the physical, chemical, and biological properties of compounds.

The synthesis of 2,6-difluorobenzoyl hydrazine typically involves the reaction of 2,6-difluorobenzoyl chloride with hydrazine, leading to the formation of the hydrazine derivative. This reaction not only highlights the versatility of hydrazine chemistry but also underscores the importance of fluorinated compounds in organic synthesis. The introduction of fluorine into organic molecules can enhance their lipophilicity, metabolic stability, and overall biological activity, making them valuable in medicinal chemistry.

One of the primary applications of 2,6-difluorobenzoyl hydrazine lies in its use as a building block in the synthesis of various pharmaceutical agents. Fluorinated compounds often exhibit improved pharmacokinetic and pharmacodynamic properties, and the incorporation of a difluorobenzoyl group can enhance the activity of bioactive molecules. Researchers have explored the use of 2,6-difluorobenzoyl hydrazine in the development of inhibitors, particularly in the context of targeting specific enzymes or receptors involved in disease processes.

In addition to its pharmaceutical applications, 2,6-difluorobenzoyl hydrazine can also serve as an intermediate in the synthesis of agrochemicals, particularly herbicides and fungicides. The development of effective crop protection agents is crucial in modern agriculture, and the incorporation of fluorine can enhance the efficacy and selectivity of these compounds. By fine-tuning the chemical structure of agrochemicals, researchers can create products that are more effective at lower doses, reducing the overall environmental impact of pesticide use.

Moreover, the unique properties of 2,6-difluorobenzoyl hydrazine make it a candidate for applications in material science. The versatility of hydrazine derivatives allows for the potential development of advanced materials, including polymers and coatings that exhibit enhanced thermal stability and mechanical properties. The introduction of fluorinated groups can improve the performance of materials under extreme conditions, making them suitable for various industrial applications.

Despite the promising applications of 2,6-difluorobenzoyl hydrazine, researchers must also consider the safety and environmental aspects associated with its use. Hydrazine and its derivatives are known to be hazardous, requiring appropriate handling and safety measures during synthesis and application. As regulations surrounding chemical safety continue to evolve, the responsible use of such compounds in research and industry remains paramount.

In conclusion, 2,6-difluorobenzoyl hydrazine is a versatile compound with significant potential in pharmaceuticals, agrochemicals, and materials science. Its discovery underscores the importance of fluorinated compounds in modern organic synthesis, providing valuable building blocks for the development of innovative products. Ongoing research into the properties and applications of this compound will likely lead to further advancements in various fields, highlighting the crucial role of chemistry in addressing contemporary challenges.
Market Analysis Reports
Related Products
2,6-Difluoroben...  2,3-Difluoroben...  2,5-Difluoroben...  2,4-Difluoroben...  3,4-Difluoroben...  2-(2,4-Difluoro...  3,4-Difluoroben...  2,6-Difluoroben...  2,4-Difluoroben...  2,4-Difluoroben...  2,6-Difluoroben...  2-(2,3-Difluoro...  2-(2,4-Difluoro...  2-(2,5-Difluoro...  2-(2,6-Difluoro...  2-(3,4-Difluoro...  2-(3,5-Difluoro...  4-(2,3-Difluoro...  4-(2,4-Difluoro...  4-(2,5-Difluoro...