| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Dibenzo(a,c)Triphenylene |
|---|---|
| Synonyms | Dibenzo(G,P)Chrysene; Nsc 30878 |
| Molecular Structure | ![]() |
| Molecular Formula | C26H16 |
| Molecular Weight | 328.41 |
| CAS Registry Number | 191-68-4 |
| EINECS | 205-890-6 |
| SMILES | C3=C2C1=CC=CC=C1C4=C(C2=CC=C3)C6=C(C5=C4C=CC=C5)C=CC=C6 |
| InChI | 1S/C26H16/c1-5-13-21-17(9-1)18-10-2-6-14-22(18)26-24-16-8-4-12-20(24)19-11-3-7-15-23(19)25(21)26/h1-16H |
| InChIKey | GQDKQZAEQBGVBS-UHFFFAOYSA-N |
| Density | 1.263g/cm3 (Cal.) |
|---|---|
| Boiling point | 604.127°C at 760 mmHg (Cal.) |
| Flash point | 314.612°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Roy Shenhar, Ronald Beust, Stefan Hagen, Hindy E. Bronstein, Itamar Willner, Lawrence T. Scott and Mordecai Rabinovitz. From bifluorenylidene dianion to dibenzo[g,p]chrysene dianion: sensitivity of anisotropy changes to bonding structure, J. Chem. Soc., Perkin Trans. 2, 2002, 0, 449. |
|---|---|
| Market Analysis Reports |