| AEchem Scientific Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (630) 364-5106 | |||
![]() |
info@aechemsc.com | |||
| Chemical manufacturer | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | L-Xylopyranose |
|---|---|
| Synonyms | (3S,4R,5S)-tetrahydro-2H-pyran-2,3,4,5-tetraol; L-(−)-Xylose, mixture of anomers; L-Xylopyranose |
| Molecular Structure | ![]() |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 |
| CAS Registry Number | 19982-83-3 |
| SMILES | C1[C@@H]([C@H]([C@@H](C(O1)O)O)O)O |
| InChI | 1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4-,5?/m0/s1 |
| InChIKey | SRBFZHDQGSBBOR-CZBDKTQLSA-N |
| Density | 1.8±0.1g/cm3 (Cal.) |
|---|---|
| 1.525 (Expl.) | |
| Melting point | 147-151°C (Expl.) |
| Boiling point | 333.2±42.0°C at 760 mmHg (Cal.) |
| Flash point | 155.3±27.9°C (Cal.) |
| Refractive index | 1.646 (Cal.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| Market Analysis Reports |