| Name | 4-{4-[(E)-Phenyldiazenyl]Phenoxy}-1-Butanethiol |
|---|---|
| Synonyms | (E)-4-(4-(Phenyldiazenyl)phenoxy)butane-1-thiol; 1-Butanethiol, 4-[4-(phenylazo)phenoxy]-; 4-(4-((1e)-phenylazo)phenoxy)-1-butanethiol |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.39 |
| CAS Registry Number | 204075-32-1 |
| SMILES | c1ccc(cc1)/N=N/c2ccc(cc2)OCCCCS |
| InChI | 1S/C16H18N2OS/c20-13-5-4-12-19-16-10-8-15(9-11-16)18-17-14-6-2-1-3-7-14/h1-3,6-11,20H,4-5,12-13H2/b18-17+ |
| InChIKey | BQNMXMPBNDYRPC-ISLYRVAYSA-N |
| Density | 1.111g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.621°C at 760 mmHg (Cal.) |
| Flash point | 225.118°C (Cal.) |
| Refractive index | 1.582 (Cal.) |
| (1) | Rafal KlajnCurrent address: Department of Organic Chemistry, Weizmann Institute of Science, 76100 Rehovot, Israel., J. Fraser Stoddart and Bartosz A. Grzybowski. Nanoparticles functionalised with reversible molecular and supramolecular switches, Chem. Soc. Rev., 2010, 39, 2203. |
|---|---|
| Market Analysis Reports |