| CAS: 2226916-90-9 Product: 7-Chlorodibenzofuran-1-ol No suppliers available. |
| Classification | Flavors and spices >> Synthetic spice >> Lactone and oxygen-containing heterocyclic compound >> Furan and pyran |
|---|---|
| Name | 7-Chlorodibenzofuran-1-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H7ClO2 |
| Molecular Weight | 218.64 |
| CAS Registry Number | 2226916-90-9 |
| SMILES | C1=CC(=C2C3=C(C=C(C=C3)Cl)OC2=C1)O |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.743, Calc.* |
| Boiling Point | 267.4±9.0 °C (760 mmHg), Calc.* |
| Flash Point | 115.5±18.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |