Online Database of Chemicals from Around the World
2-((Tert-butoxycarbonyl)amino)-4,4,4-trifluoro-3,3-dimethylbutanoic acid
[CAS 2242426-49-7]
Identification| Name | 2-((Tert-butoxycarbonyl)amino)-4,4,4-trifluoro-3,3-dimethylbutanoic acid |
|---|
| Synonyms | 4,4,4-trifluoro-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|
| Molecular Structure |  |
| Molecular Formula | C11H18F3NO4 |
| Molecular Weight | 285.26 |
| CAS Registry Number | 2242426-49-7 |
| EC Number | 843-903-2 |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)C(C)(C)C(F)(F)F |
|
Properties
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.429, Calc.* |
| Boiling Point | 340.8±42.0 °C (760 mmHg), Calc.* |
| Flash Point | 159.9±27.9 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Safety Data
| Hazard Symbols | GHS07 Warning Details |
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details |
| Hazard Classification |
|
| Hazard | Class | Category Code | Hazard Statement |
| Eye irritation | Eye Irrit. | 2A | H319 |
| Acute toxicity | Acute Tox. | 4 | H302 |
| Skin irritation | Skin Irrit. | 2 | H315 |
| Specific target organ toxicity - single exposure | STOT SE | 3 | H335 |
|
| SDS | Available |
|
Related Products