| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1-{4-[(E)-(4-Methoxybenzylidene)Amino]Phenyl}Ethanone |
|---|---|
| Synonyms | 1-(4-(((4-Methoxyphenyl)methylene)amino)phenyl)ethanone; 4'-((4-Methoxybenzylidene)amino)acetophenone; 4-ACETYL-N- ANILIN& |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 |
| CAS Registry Number | 23596-02-3 |
| SMILES | COc2ccc(/C=N/c1ccc(cc1)C(C)=O)cc2 |
| InChI | 1S/C16H15NO2/c1-12(18)14-5-7-15(8-6-14)17-11-13-3-9-16(19-2)10-4-13/h3-11H,1-2H3/b17-11+ |
| InChIKey | NTBVIRZMEMSQEJ-GZTJUZNOSA-N |
| Density | 1.056g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.809°C at 760 mmHg (Cal.) |
| Flash point | 193.088°C (Cal.) |
| Refractive index | 1.547 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Xu J, Zhang Q, Chen L, Chen H. Chemoselectivity in reactions of α-diazo-β-diketone with some conjugative double-bond systems, Perkin Transactions 1(18), 2001, 2266-2268 |
|---|---|
| Market Analysis Reports |