Online Database of Chemicals from Around the World
3,9-Bis(isodecyloxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane
[CAS 26544-27-4]
Identification| Name | 3,9-Bis(isodecyloxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
|---|
| Synonyms | Diisodecyl pentaerythritol diphosphite; Doverphos 1220; HI-M-O; Pentaerythritol bis(isodecyl phosphite); Weston 600; Yiphos 3010 |
|
| Molecular Structure | ![3,9-Bis(isodecyloxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane molecular structure (CAS 26544-27-4)](/structures/26544-27-4.png) |
| Molecular Formula | C25H50O6P2 |
| Molecular Weight | 508.61 |
| CAS Registry Number | 26544-27-4 |
| EC Number | 247-779-5 |
| SMILES | CC(C)CCCCCCCOP1OCC2(CO1)COP(OC2)OCCCCCCCC(C)C |
|
Properties
| Boiling Point | 531.1±50.0 °C (760 mmHg), Calc.* |
| Flash Point | 344.6±30.4 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Safety Data
| Hazard Classification |
|
| Hazard | Class | Category Code | Hazard Statement |
| Chronic hazardous to the aquatic environment | Aquatic Chronic | 4 | H413 |
|
Related Products
1,3-Bis(1-Isocy... Bis[[3-(Isocyan... Bis[[3-(Isocyan... 1,3-Bis(5-Isocy... N,N'-Bis(3-isoc... 1-{2,2-Bis[(4-I... 1,3-Bis[4-[(4-I... 1,4-Bis(2-Isocy... 1,3-Bis(2-isocy... 1,3-Bis(Isocyan... 1,1'-Bis(Isomen... 5,7-Bis(isopent... Bis(Isopropenyl... 1,4-Bis(Isoprop... Bis(Isopropoxy)... N1,N2-Bis(4-Iso... Bis(2-isopropox... Bis(2-isopropox... Bis(isopropoxyt... Bis-Isopropylam...