|
CAS#: 281-54-9 Product: Pentacyclo[19.3.1.13,7.19,13.115,19]Octacosa-1(25),3(28),4,6,9(27),10,12,15(26),16,18,21,23-Dodecaene No suppilers available for the product. |
| Name | Pentacyclo[19.3.1.13,7.19,13.115,19]Octacosa-1(25),3(28),4,6,9(27),10,12,15(26),16,18,21,23-Dodecaene |
|---|---|
| Synonyms | InChI=1/C |
| Molecular Structure | ![]() |
| Molecular Formula | C28H24 |
| Molecular Weight | 360.49 |
| CAS Registry Number | 281-54-9 |
| SMILES | C1C2=CC(=CC=C2)CC3=CC(=CC=C3)CC4=CC=CC(=C4)CC5=CC=CC1=C5 |
| InChI | 1S/C28H24/c1-5-21-13-22(6-1)18-24-8-3-10-26(15-24)20-28-12-4-11-27(16-28)19-25-9-2-7-23(14-25)17-21/h1-16H,17-20H2 |
| InChIKey | GQPLZGRPYWLBPW-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 525.7±45.0°C at 760 mmHg (Cal.) |
| Flash point | 270.6±22.8°C (Cal.) |
| Refractive index | 1.621 (Cal.) |
| (1) | Tomoki Ogoshi, Yoko Nishida, Tada-aki Yamagishi and Yoshiaki Nakamoto. Synthesis and host–guest properties of an alternating copolymer containing calix[4]arene and calix[6]arene in its main chain, Polym. Chem., 2010, 1, 203. |
|---|---|
| Market Analysis Reports |