| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 4-Ethenyl-7-Methoxy-1,2-Dihydronaphthalene |
|---|---|
| Synonyms | 7-Methoxy-4-Vinyl-1,2-Dihydronaphthalene; 4-Ethenyl-1,2-Dihydro-7-Methoxynaphthalene; Naphthalene, 4-Ethenyl-1,2-Dihydro-7-Methoxy- |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 |
| CAS Registry Number | 2811-50-9 |
| SMILES | C1=C(OC)C=CC2=C1CCC=C2C=C |
| InChI | 1S/C13H14O/c1-3-10-5-4-6-11-9-12(14-2)7-8-13(10)11/h3,5,7-9H,1,4,6H2,2H3 |
| InChIKey | OFLAWVBFSWUQFG-UHFFFAOYSA-N |
| Density | 1.08g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.174°C at 760 mmHg (Cal.) |
| Flash point | 116.246°C (Cal.) |
| (1) | Michael Essers and Günter Haufe. Chemical consequences of fluorine substitution. Part 4. Diels–Alder reactions of fluorinated p-benzoquinones with Dane's diene. Synthesis of fluorinated D-homosteroids, J. Chem. Soc., Perkin Trans. 1, 2002, 0, 2719. |
|---|---|
| Market Analysis Reports |