|
CAS#: 29407-84-9 Product: Bisphenol A Polymer with 2-(butoxymethyl)oxirane and 2-(chloromethyl)oxirane No suppilers available for the product. |
| Name | Bisphenol A Polymer with 2-(butoxymethyl)oxirane and 2-(chloromethyl)oxirane |
|---|---|
| Synonyms | 2-(Butoxymethyl)Oxirane; 2-(Chloromethyl)Oxirane; 4-[1-(4-Hydroxyphenyl)-1-Methyl-Ethyl]Phenol; 2-(Butoxymethyl)Oxirane; 2-(Chloromethyl)Oxirane; 4-[1-(4-Hydroxyphenyl)-1-Methylethyl]Phenol |
| Molecular Formula | C25H35ClO5 |
| Molecular Weight | 451.00 |
| CAS Registry Number | 29407-84-9 |
| SMILES | C(Cl)C1OC1.C(OCCCC)C2OC2.C4=C(C(C3=CC=C(O)C=C3)(C)C)C=CC(=C4)O |
| InChI | 1S/C15H16O2.C7H14O2.C3H5ClO/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;1-2-3-4-8-5-7-6-9-7;4-1-3-2-5-3/h3-10,16-17H,1-2H3;7H,2-6H2,1H3;3H,1-2H2 |
| InChIKey | QTEOSOFWVLJIPG-UHFFFAOYSA-N |
| Boiling point | 400.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 192.4°C (Cal.) |
| Market Analysis Reports |