| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 1-(1H-Imidazol-1-Yl)-3-Phenyl-2-Propen-1-One |
|---|---|
| Synonyms | (E)-1-Imidazol-1-Yl-3-Phenylprop-2-En-1-One; 1-Imidazol-1-Yl-3-Phenyl-Prop-2-En-1-One; (E)-1-Imidazol-1-Yl-3-Phenyl-Prop-2-En-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 |
| CAS Registry Number | 2979-51-3 |
| EINECS | 221-036-5 |
| SMILES | C1=CN=C[N]1C(\C=C\C2=CC=CC=C2)=O |
| InChI | 1S/C12H10N2O/c15-12(14-9-8-13-10-14)7-6-11-4-2-1-3-5-11/h1-10H/b7-6+ |
| InChIKey | XVGXMXZUJNAGFZ-VOTSOKGWSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 128-132°C (Expl.) |
| Boiling point | 391.8±35.0°C at 760 mmHg (Cal.) |
| Flash point | 190.7±25.9°C (Cal.) |
| Safety Code | S26;S37 Details |
|---|---|
| Risk Code | R36/37/38 Details |
| Hazard Symbol | X Details |
| Safety Description | IRRITANT |
| WARNING: Irritates lungs, eyes, skin | |
| (1) | Christopher Oldfield, Robert. B. Freedman and Brian H. Robinson. Enzyme hyperactivity in AOT water-in-oil microemulsions is induced by ‘lone’ sodium counterions in the water-pool, Faraday Discuss., 2005, 129, 247. |
|---|---|
| Market Analysis Reports |