|
CAS#: 34622-68-9 Product: Butan-2-Yl 2,2-Dichloroethenyl Methyl Phosphate No suppilers available for the product. |
| Name | Butan-2-Yl 2,2-Dichloroethenyl Methyl Phosphate |
|---|---|
| Synonyms | 2,2-Dichlorovinyl Methyl Sec-Butyl Phosphate; Phosphoric Acid 2,2-Dichlorovinyl Methyl Sec-Butyl Ester; 2,2-Dichlorovinyl Butyl Methyl Ester Of Phosphoric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13Cl2O4P |
| Molecular Weight | 263.06 |
| CAS Registry Number | 34622-68-9 |
| SMILES | C(C)C(C)O[P](=O)(OC)OC=C(Cl)Cl |
| InChI | 1S/C7H13Cl2O4P/c1-4-6(2)13-14(10,11-3)12-5-7(8)9/h5-6H,4H2,1-3H3 |
| InChIKey | DWORZBHHACHFTC-UHFFFAOYSA-N |
| Density | 1.29g/cm3 (Cal.) |
|---|---|
| Boiling point | 234.158°C at 760 mmHg (Cal.) |
| Flash point | 88.919°C (Cal.) |
| Market Analysis Reports |