|
CAS#: 35381-44-3 Product: 2,5-Furandione, polymer with ethenylbenzene and 2-propen-1-ol No suppilers available for the product. |
| Name | 2,5-Furandione, polymer with ethenylbenzene and 2-propen-1-ol |
|---|---|
| Synonyms | Furan-2,5-Quinone; Prop-2-En-1-Ol; Styrene; Ethenylbenzene; Furan-2,5-Dione; Prop-2-En-1-Ol |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 |
| CAS Registry Number | 35381-44-3 |
| SMILES | O=C1OC(=O)C=C1.C(O)C=C.C2=C(C=CC=C2)C=C |
| InChI | 1S/C8H8.C4H2O3.C3H6O/c1-2-8-6-4-3-5-7-8;5-3-1-2-4(6)7-3;1-2-3-4/h2-7H,1H2;1-2H;2,4H,1,3H2 |
| InChIKey | ACXGSQOPPZJZNE-UHFFFAOYSA-N |
| Boiling point | 145.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 31.1°C (Cal.) |
| Market Analysis Reports |