| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Florida Center for Heterocyclic Compounds | USA | |||
|---|---|---|---|---|
![]() |
+1 (352) 392-0554 | |||
![]() |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Gelest, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (215) 547-1015 | |||
![]() |
info@gelest.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1-(Trimethylsilyl)-1H-Benzotriazole |
|---|---|
| Synonyms | 1-(Trimethylsilyl)-1H-benzotriazol; 1-Trimethylsilyl-1H-Benzotriazole; 1-TRIMETHYLSILYLBENZOTRIAZOLE |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13N3Si |
| Molecular Weight | 191.31 |
| CAS Registry Number | 48183-36-4 |
| SMILES | n1nn(c2ccccc12)[Si](C)(C)C |
| InChI | 1S/C9H13N3Si/c1-13(2,3)12-9-7-5-4-6-8(9)10-11-12/h4-7H,1-3H3 |
| InChIKey | VHOLOZYRMQVHBK-UHFFFAOYSA-N |
| Density | 1.08g/cm3 (Cal.) |
|---|---|
| Boiling point | 251.042°C at 760 mmHg (Cal.) |
| Flash point | 105.627°C (Cal.) |
| Refractive index | 1.545 (Expl.) |
| (1) | Thomas Foerster, Derek A. Wann, Heather E. Robertson and David W. H. Rankin. Why are trimethylsilyl groups asymmetrically coordinated? Gas-phase molecular structures of 1-trimethylsilyl-1,2,3-benzotriazole and 2-trimethylsilyl-1,3-thiazole, Dalton Trans., 2009, 3026. |
|---|---|
| Market Analysis Reports |