| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | (S)-9,11,12,13,13a,14-Hexahydro-2,3,6,7-Tetramethoxydibenzo[f,h]Pyrrol O(1,2-b)Isoquinoline |
|---|---|
| Synonyms | 9,11,12,13,13A,14-Hexahydro-2,3,6,7-Tetramethoxydibenzo[F,H]Pyrrolo[1,2-B]Isoquinoline; Dibenzo[F,H]Pyrrolo[1,2-B]Isoquinoline, 9,11,12,13,13A,14-Hexahydro-2,3,6,7-Tetramethoxy-; Dibenzo[F,H]Pyrrolo[1,2-B]Isoquinoline, 9,11,12,13,13A,14-Hexahydro-2,3,6,7-Tetramethoxy-, (S)- |
| Molecular Structure | ![]() |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 |
| CAS Registry Number | 482-20-2 |
| SMILES | [C@@H]45N(CC1=C(C3=C(C2=C1C=C(C(=C2)OC)OC)C=C(OC)C(=C3)OC)C4)CCC5 |
| InChI | 1S/C24H27NO4/c1-26-21-9-16-15-8-14-6-5-7-25(14)13-20(15)19-12-24(29-4)23(28-3)11-18(19)17(16)10-22(21)27-2/h9-12,14H,5-8,13H2,1-4H3/t14-/m0/s1 |
| InChIKey | SSEUDFYBEOIWGF-AWEZNQCLSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 559.9±45.0°C at 760 mmHg (Cal.) |
| Flash point | 160.5±25.9°C (Cal.) |
| (1) | McIver Andrew. A general approach to triphenylenes and azatriphenylenes: total synthesis of dehydrotylophorine and tylophorine, Chemical Communications, 2008 |
|---|---|
| Market Analysis Reports |