| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Quality Phytochemicals LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (908) 510-9277 | |||
![]() |
sales@qualityphytochemicalsllc.com | |||
| Chemical manufacturer | ||||
| Tocris Bioscience Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | (-)-Isoreserpine |
|---|---|
| Synonyms | Chemdiv1_007189; Mepireserpate; 20.Alpha.-Yohimban-16.Beta.-Carboxylic Acid, 18.Beta.-Hydroxy-11,17.Alpha.-Dimethoxy-, Methyl Ester, 3,4,5-Trimethoxybenzoate (Ester) |
| Molecular Structure | ![]() |
| Molecular Formula | C33H40N2O9 |
| Molecular Weight | 608.69 |
| CAS Registry Number | 482-85-9 |
| SMILES | C1=CC(=CC6=C1C5=C(C4N(CC3CC(OC(C2=CC(=C(OC)C(=C2)OC)OC)=O)C(C(C3C4)C(OC)=O)OC)CC5)[NH]6)OC |
| InChI | 1S/C33H40N2O9/c1-38-19-7-8-20-21-9-10-35-16-18-13-27(44-32(36)17-11-25(39-2)30(41-4)26(12-17)40-3)31(42-5)28(33(37)43-6)22(18)15-24(35)29(21)34-23(20)14-19/h7-8,11-12,14,18,22,24,27-28,31,34H,9-10,13,15-16H2,1-6H3 |
| InChIKey | QEVHRUUCFGRFIF-UHFFFAOYSA-N |
| Density | 1.329g/cm3 (Cal.) |
|---|---|
| Boiling point | 700.058°C at 760 mmHg (Cal.) |
| Flash point | 377.182°C (Cal.) |
| solubility | Soluble to 100 mM in DMSO |
| (1) | Manthena V. S. Varma, Khandavilli Sateesh, and Ramesh Panchagnula. Functional Role of P-Glycoprotein in Limiting Intestinal Absorption of Drugs: Contribution of Passive Permeability to P-Glycoprotein Mediated Efflux Transport, Mol. Pharmaceutics 2005, 2(1), 12-21. |
|---|---|
| Market Analysis Reports |