| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Chemical reagent >> Organic reagent >> Acid halide |
|---|---|
| Name | 4-n-Hexylbenzoyl Chloride |
| Synonyms | 222097_Aldrich; Zinc02140822 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17ClO |
| Molecular Weight | 224.73 |
| CAS Registry Number | 50606-95-6 |
| EINECS | 256-647-6 |
| SMILES | C1=C(C=CC(=C1)CCCCCC)C(=O)Cl |
| InChI | 1S/C13H17ClO/c1-2-3-4-5-6-11-7-9-12(10-8-11)13(14)15/h7-10H,2-6H2,1H3 |
| InChIKey | XRAHLPNMIIAEPP-UHFFFAOYSA-N |
| Density | 1.029 (Expl.) |
|---|---|
| 1.0±0.1g/cm3 (Cal.) | |
| Boiling point | 176-177°C (Expl.) |
| 305.2±21.0°C at 760 mmHg (Cal.) | |
| Flash point | 140.0±15.2°C (Cal.) |
| 110°C (Expl.) | |
| Refractive index | 1.5256 (Expl.) |
| Safety Code | S26;S36/37/39;S45 Details |
|---|---|
| Risk Code | R34 Details |
| Hazard Symbol | C Details |
| Transport Information | UN3265 |
| Safety Description | DANGER: CORROSIVE, burns skin and eyes |
| DANGER: CORROSIVE, Water reactive, burns skin and eyes. | |
| SDS | Available |
| Market Analysis Reports |