| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | n-Butyl Phosphate |
|---|---|
| Synonyms | Monobutylphosphate Mixture With Dibutylphosphate; Nsc2182 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H30O8P2 |
| Molecular Weight | 364.31 |
| CAS Registry Number | 52933-01-4 |
| SMILES | C(O[P](=O)(OCCCC)O)CCC.C(O[P](=O)(O)O)CCC |
| InChI | 1S/C8H19O4P.C4H11O4P/c1-3-5-7-11-13(9,10)12-8-6-4-2;1-2-3-4-8-9(5,6)7/h3-8H2,1-2H3,(H,9,10);2-4H2,1H3,(H2,5,6,7) |
| InChIKey | ORMYKVYVDRWAKI-UHFFFAOYSA-N |
| Density | 1.123 (Expl.) |
|---|---|
| Melting point | -60°C (Expl.) |
| Boiling point | 124°C (Expl.) |
| Flash point | 110°C (Expl.) |
| Refractive index | 1.429 (Expl.) |
| Safety Code | S20;S23;S26;S36/37/39;S45;S60 Details |
|---|---|
| Risk Code | R34 Details |
| Hazard Symbol | C Details |
| Transport Information | UN1718 |
| Safety Description | WARNING: Causes GI injury, skin and eye irritation |
| SDS | Available |
| Market Analysis Reports |