|
CAS#: 613-83-2 Product: D-Ribofuranose No suppilers available for the product. |
| Name | D-Ribofuranose |
|---|---|
| Synonyms | (3R,4S,5R)-5-(hydroxymethyl)tetrahydrofuran-2,3,4-triol; 4-01-00-04211 (Beilstein Handbook Reference); D-(-)-Ribose |
| Molecular Structure | ![]() |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 |
| CAS Registry Number | 613-83-2 |
| SMILES | C([C@@H]1[C@H]([C@H](C(O1)O)O)O)O |
| InChI | 1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3-,4-,5?/m1/s1 |
| InChIKey | HMFHBZSHGGEWLO-SOOFDHNKSA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.4±42.0°C at 760 mmHg (Cal.) |
| Flash point | 180.8±27.9°C (Cal.) |
| (1) | Gonzalez Orland. Reconstruction, modeling & analysis of Halobacterium salinarum R-1 metabolism, Molecular BioSystems, 2008 |
|---|---|
| Market Analysis Reports |