| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | 1-Hydroxy-9-Fluorenone |
|---|---|
| Synonyms | 1-Hydroxy-9-Fluorenone; Zinc00158025; Sbb016924 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8O2 |
| Molecular Weight | 196.21 |
| CAS Registry Number | 6344-60-1 |
| EINECS | 228-746-4 |
| SMILES | C3=C2C1=C(C=CC=C1)C(C2=C(C=C3)O)=O |
| InChI | 1S/C13H8O2/c14-11-7-3-6-9-8-4-1-2-5-10(8)13(15)12(9)11/h1-7,14H |
| InChIKey | QUUNMPSDKIURJD-UHFFFAOYSA-N |
| Density | 1.37g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.412°C at 760 mmHg (Cal.) |
| Flash point | 163.711°C (Cal.) |
| (1) | Zhao et al.. Chemical genetic interrogation of natural variation uncovers a molecule that is glyco-activated, Nature Chemical Biology, 2007 |
|---|---|
| Market Analysis Reports |