| Abblis Chemicals LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (832) 373-8299 | |||
![]() |
info@abblis.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| CacheSyn Inc. | Canada | |||
|---|---|---|---|---|
![]() |
+1 (416) 996-8186 | |||
![]() |
info@cachesyn.com | |||
| Chemical manufacturer | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Bethanechol |
|---|---|
| Synonyms | 2-Carbamoyloxypropyl-Trimethyl-Ammonium Chloride; 2-Carbamoyloxypropyl-Trimethylammonium Chloride; 2-Aminocarbonyloxypropyl-Trimethyl-Azanium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C7H17ClN2O2 |
| Molecular Weight | 196.68 |
| CAS Registry Number | 674-38-4 |
| SMILES | C([N+](C)(C)C)C(OC(N)=O)C.[Cl-] |
| InChI | 1S/C7H16N2O2.ClH/c1-6(11-7(8)10)5-9(2,3)4;/h6H,5H2,1-4H3,(H-,8,10);1H |
| InChIKey | XXRMYXBSBOVVBH-UHFFFAOYSA-N |
| (1) | Min Kyung Kim, Vinna Jo, Dong Woo Lee, Il-Wun Shim and Kang Min Ok. CAU-1 and CAU-2: New tubular alkali metal–organic framework materials, A[CH(CO)(COH)(COH)] (A = K or Rb), CrystEngComm, 2010, 12, 1481. |
|---|---|
| Market Analysis Reports |