| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Eburon Organics bvba | Belgium | |||
|---|---|---|---|---|
![]() |
+32 (51) 335-068 | |||
![]() |
sales@eburon-organics.com | |||
| Chemical manufacturer | ||||
| Gelest, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (215) 547-1015 | |||
![]() |
info@gelest.com | |||
| Chemical manufacturer | ||||
| Name | Tributyl(2-methyl-2-propen-1-yl)stannane |
|---|---|
| Synonyms | Methallyltri-n-butylstannane; METHALLYLTRI-N-BUTYLTIN; Tri-n-butyl(2-methyl-2-propenyl)stannane |
| Molecular Structure | ![]() |
| Molecular Formula | C16H34Sn |
| Molecular Weight | 345.15 |
| CAS Registry Number | 67883-62-9 |
| SMILES | CCCC[Sn](CCCC)(CCCC)CC(=C)C |
| InChI | 1S/C4H7.3C4H9.Sn/c1-4(2)3;3*1-3-4-2;/h1-2H2,3H3;3*1,3-4H2,2H3; |
| InChIKey | CYIUFVYZGOCGEV-UHFFFAOYSA-N |
| Boiling point | 328.6±35.0°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 156.7±13.0°C (Cal.) |
| Refractive index | 1.4875 (Expl.) |
| Safety Code | S35;S36/37/39;S45;S60;S61 Details |
|---|---|
| Risk Code | R21;R25;R36/38;R48/23/25;R50/53 Details |
| Hazard Symbol | T;N Details |
| Transport Information | UN2788 |
| Safety Description | DANGER: POISON, irritates skin, eyes, lungs |
| SDS | Available |
| (1) | Jianguo Wu and Nilay Hazari. Palladium catalyzed carboxylation of allylstannanes and boranes using CO2, Chem. Commun., 2011, 47, 1069. |
|---|---|
| Market Analysis Reports |