|
CAS#: 82-12-2 Product: Rufigallol No suppilers available for the product. |
| Name | Rufigallol |
|---|---|
| Synonyms | 1,2,3,5,6,7-Hexahydroxy-9,10-Anthraquinone; 1,2,3,5,6,7-Hexahydroxy-9,10-Anthracenedione; Chebi:37500 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8O8 |
| Molecular Weight | 304.21 |
| CAS Registry Number | 82-12-2 |
| SMILES | C1=C(C(=C(O)C3=C1C(=O)C2=C(C(=C(C=C2C3=O)O)O)O)O)O |
| InChI | 1S/C14H8O8/c15-5-1-3-7(13(21)11(5)19)10(18)4-2-6(16)12(20)14(22)8(4)9(3)17/h1-2,15-16,19-22H |
| InChIKey | NEIMTOOWBACOHT-UHFFFAOYSA-N |
| Density | 2.033g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.887°C at 760 mmHg (Cal.) |
| Flash point | 285.32°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Hari Krishna Bisoyi and Sandeep Kumar. Carbon nanotubes in triphenylene and rufigallol-based room temperature monomeric and polymeric discotic liquid crystals, J. Mater. Chem., 2008, 18, 3032. |
|---|---|
| Market Analysis Reports |