Online Database of Chemicals from Around the World

N-(3-Phthalimido-2-(R)-hydroxypropyl)-3-fluoro-4-(morpholinyl)aniline
[CAS 874340-08-6]

List of Suppliers
Chizhou Dongsheng Pharmaceutical Co., Ltd. China
www.dspharmchem.com
+86 (576) 8429-2571
+86 (576) 8429-2560
ksz@dspharmchem.com
Chemical manufacturer since 1995
chemBlink Premium supplier since 2011
Identification
ClassificationOrganic raw materials >> Aryl compounds >> Anilines
NameN-(3-Phthalimido-2-(R)-hydroxypropyl)-3-fluoro-4-(morpholinyl)aniline
Synonyms2-[(2R)-3-[[3-Fluoro-4-(4-morpholinyl)phenyl]amino]-2-hydroxypropyl]-1,3-isoindolinedione
Molecular StructureN-(3-Phthalimido-2-(R)-hydroxypropyl)-3-fluoro-4-(morpholinyl)aniline molecular structure (CAS 874340-08-6)
Molecular FormulaC21H22FN3O4
Molecular Weight399.42
CAS Registry Number874340-08-6
SMILESC1COCCN1C2=C(C=C(C=C2)NC[C@H](CN3C(=O)C4=CC=CC=C4C3=O)O)F
Properties
Density1.397
up chemBlink Chemical Story
N-(3-Phthalimido-2-(R)-hydroxypropyl)-3-fluoro-4-(morpholinyl)aniline is a noteworthy chemical compound that has garnered attention for its unique structure and potential applications. This molecule features a complex arrangement with a phthalimide group, a hydroxypropyl unit, a fluorinated aniline moiety, and a morpholinyl ring. The combination of these structural elements imparts distinctive chemical and biological properties to the compound.

The discovery of N-(3-Phthalimido-2-(R)-hydroxypropyl)-3-fluoro-4-(morpholinyl)aniline stems from ongoing research in organic chemistry aimed at developing compounds with enhanced functional properties. The incorporation of a phthalimide group and a morpholinyl ring into the aniline structure provides increased stability and reactivity, which are crucial for various applications. The fluorine atom in the aniline ring further modifies the electronic properties of the molecule, making it a valuable target for synthetic chemists.

One of the primary applications of this compound lies in its potential as a pharmaceutical intermediate. The phthalimide and hydroxypropyl groups are known to contribute to improved solubility and bioactivity, making the compound a suitable candidate for drug development. Additionally, the presence of the morpholinyl group enhances the molecule's interaction with biological targets, potentially leading to novel therapeutic agents. Research has indicated that such compounds may exhibit significant biological activity, including antibacterial and antifungal properties.

In the field of materials science, N-(3-Phthalimido-2-(R)-hydroxypropyl)-3-fluoro-4-(morpholinyl)aniline's unique structure allows it to be used as a building block for the synthesis of advanced materials. The fluorinated aniline unit and morpholinyl ring can influence the material's physical properties, such as thermal stability and mechanical strength. This makes the compound an attractive option for developing high-performance materials with specific characteristics.

The compound's versatility extends to its potential use in chemical synthesis as well. Its reactive functional groups can be exploited in the formation of more complex molecules, facilitating the creation of diverse chemical products. This capability highlights the compound's role in advancing synthetic methodologies and expanding the range of available chemical tools.

Overall, N-(3-Phthalimido-2-(R)-hydroxypropyl)-3-fluoro-4-(morpholinyl)aniline represents a significant advancement in chemical research with promising applications in pharmaceuticals, materials science, and synthetic chemistry.
Market Analysis Reports
Related Products
2-Phthalimidoet...  2-Phthalimidoet...  2-Phthalimido-E...  N-(2-(2-Phthali...  2-[2-(2-Phthali...  2-Phthalimidoet...  2-Phthalimidoet...  2-Phthalimidoet...  6-Phthalimido-1...  4-(Phthalimido)...  2-Phthalimidola...  Phthalimidomalo...  N-(Phthalimidom...  2-Phthalimido-3...  6-(Phthalimidom...  6-(Phthalimidom...  4-Phthalimidome...  (3-Phthalimidom...  (2-Phthalimidom...  5-(N-Phthalimid...