Online Database of Chemicals from Around the World
Methyl {8-fluoro-3-[2-methoxy-5-(trifluoromethyl)phenyl]-2-oxo-1,2,3,4-tetrahydro-4-quinazolinyl}acetate
[CAS 917389-21-0]
Identification| Name | Methyl {8-fluoro-3-[2-methoxy-5-(trifluoromethyl)phenyl]-2-oxo-1,2,3,4-tetrahydro-4-quinazolinyl}acetate |
|---|
|
| Molecular Structure | ![Methyl {8-fluoro-3-[2-methoxy-5-(trifluoromethyl)phenyl]-2-oxo-1,2,3,4-tetrahydro-4-quinazolinyl}acetate molecular structure (CAS 917389-21-0)](/structures/917389-21-0.png) |
| Molecular Formula | C19H16F4N2O4 |
| Molecular Weight | 412.33 |
| CAS Registry Number | 917389-21-0 |
| EC Number | 801-725-2 |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)N2C(C3=C(C(=CC=C3)F)NC2=O)CC(=O)OC |
|
Properties
| Solubility | 3.13 mg/L (25 °C water) |
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.523, Calc.* |
| Melting point | 204.99 °C |
| Boiling Point | 483.71 °C, 505.1±50.0 °C (760 mmHg), Calc.* |
| Flash Point | 259.3±30.1 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Safety Data
| Hazard Symbols | GHS07 Warning Details |
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261 Details |
| Hazard Classification |
|
| Hazard | Class | Category Code | Hazard Statement |
| Chronic hazardous to the aquatic environment | Aquatic Chronic | 2 | H411 |
|
| SDS | Available |
|
Related Products