| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Hydroxyindolo[2,1-b]quinazoline-6,12-dione |
|---|---|
| Synonyms | 4-Hydroxy-10b-hydroindolino[2,1-b]quinazoline-6,11-dione; 4-hydroxyindolo[2,1-b]quinazoline-6,12-dione; A-ring substituted tryptanthrin derivative |
| Molecular Structure | ![]() |
| Molecular Formula | C15H8N2O3 |
| Molecular Weight | 264.24 |
| CAS Registry Number | 959348-06-2 |
| SMILES | O=C4C\2=N\c1c(O)cccc1C(=O)N/2c3ccccc34 |
| InChI | 1S/C15H8N2O3/c18-11-7-3-5-9-12(11)16-14-13(19)8-4-1-2-6-10(8)17(14)15(9)20/h1-7,18H |
| InChIKey | JMQBMIIZIYYESH-UHFFFAOYSA-N |
| Density | 1.579g/cm3 (Cal.) |
|---|---|
| Boiling point | 526.581°C at 760 mmHg (Cal.) |
| Flash point | 272.267°C (Cal.) |
| Refractive index | 1.792 (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |